C27H26N2O5 — CID 162245829
5-[(5-ethyl-6-oxoheptyl)amino]-5-oxo-2-(trideca-2,4,6,8,10,12-hexaynoylamino)pentanoic acid (PubChem CID 162245829) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 5-[(5-ethyl-6-oxoheptyl)amino]-5-oxo-2-(trideca-2,4,6,8,10,12-hexaynoylamino)pentanoic acid.
| Compound Name | 5-[(5-ethyl-6-oxoheptyl)amino]-5-oxo-2-(trideca-2,4,6,8,10,12-hexaynoylamino)pentanoic acid |
|---|---|
| PubChem CID | 162245829 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 5-[(5-ethyl-6-oxoheptyl)amino]-5-oxo-2-(trideca-2,4,6,8,10,12-hexaynoylamino)pentanoic acid |
| SMILES | C#CC#CC#CC#CC#CC#CC(=O)NC(CCC(=O)NCCCCC(CC)C(C)=O)C(=O)O |
| InChI | InChI=1S/C27H26N2O5/c1-4-6-7-8-9-10-11-12-13-14-18-26(32)29-24(27(33)34)19-20-25(31)28-21-16-15-17-23(5-2)22(3)30/h1,23-24H,5,15-17,19-21H2,2-3H3,(H,28,31)(H,29,32)(H,33,34) |
| InChIKey | LWNAERJOCBOJAS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|