C13H22BNO4 — CID 158613455
CID 158613455 (PubChem CID 158613455) has the molecular formula C13H22BNO4 and a molecular weight of 267.13 g/mol.
| Compound Name | CID 158613455 |
|---|---|
| PubChem CID | 158613455 |
| Molecular Formula | C13H22BNO4 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)CCC(=O)NCCCCC(CC)C(C)=O |
| InChI | InChI=1S/C13H22BNO4/c1-3-11(10(2)16)6-4-5-9-15-12(17)7-8-13(18)19-14/h11H,3-9H2,1-2H3,(H,15,17) |
| InChIKey | OETZRYVVLWKRKE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|