C22H30N6O — CID 143870670
2-[1-[(4-aminobutylamino)methyl]pyrido[3,4-b]indol-9-yl]-1-piperazin-1-ylethanone (PubChem CID 143870670) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[1-[(4-aminobutylamino)methyl]pyrido[3,4-b]indol-9-yl]-1-piperazin-1-ylethanone.
| Compound Name | 2-[1-[(4-aminobutylamino)methyl]pyrido[3,4-b]indol-9-yl]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 143870670 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-[1-[(4-aminobutylamino)methyl]pyrido[3,4-b]indol-9-yl]-1-piperazin-1-ylethanone |
| SMILES | NCCCCNCc1nccc2c3ccccc3n(CC(=O)N3CCNCC3)c12 |
| InChI | InChI=1S/C22H30N6O/c23-8-3-4-9-25-15-19-22-18(7-10-26-19)17-5-1-2-6-20(17)28(22)16-21(29)27-13-11-24-12-14-27/h1-2,5-7,10,24-25H,3-4,8-9,11-16,23H2 |
| InChIKey | XHZGJNTYCCHSGG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|