(2-methoxy-4-pyridinyl)borinic acid

C6H8BNO2 — CID 143871240

IUPAC(2-methoxy-4-pyridinyl)borinic acid
SMILESCOc1cc(BO)ccn1
InChIInChI=1S/C6H8BNO2/c1-10-6-4-5(7-9)2-3-8-6/h2-4,7,9H,1H3
InChIKeyCCFVONMACICTOY-UHFFFAOYSA-N
MW136.95 g/mol
LogP-0.94
Rot. Bonds2

About (2-methoxy-4-pyridinyl)borinic acid

(2-methoxy-4-pyridinyl)borinic acid (PubChem CID 143871240) has the molecular formula C6H8BNO2 and a molecular weight of 136.95 g/mol. Its IUPAC name is (2-methoxy-4-pyridinyl)borinic acid.

Molecular Properties

Compound Name(2-methoxy-4-pyridinyl)borinic acid
PubChem CID143871240
Molecular FormulaC6H8BNO2
Molecular Weight136.95 g/mol
Exact Mass137.06
IUPAC Name(2-methoxy-4-pyridinyl)borinic acid
SMILESCOc1cc(BO)ccn1
InChIInChI=1S/C6H8BNO2/c1-10-6-4-5(7-9)2-3-8-6/h2-4,7,9H,1H3
InChIKeyCCFVONMACICTOY-UHFFFAOYSA-N
XLogP-0.94
TPSA42.35 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500136.95
LogP ≤ 5-0.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-methoxy-4-pyridinyl)borinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methoxy-4-pyridinyl)borinic acid?
The IUPAC name of (2-methoxy-4-pyridinyl)borinic acid (CID 143871240) is (2-methoxy-4-pyridinyl)borinic acid.
What is the SMILES notation for (2-methoxy-4-pyridinyl)borinic acid?
The canonical SMILES for (2-methoxy-4-pyridinyl)borinic acid is COc1cc(BO)ccn1.
What is the InChIKey of (2-methoxy-4-pyridinyl)borinic acid?
The InChIKey is CCFVONMACICTOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BNO2/c1-10-6-4-5(7-9)2-3-8-6/h2-4,7,9H,1H3.
What are the key properties of (2-methoxy-4-pyridinyl)borinic acid?
(2-methoxy-4-pyridinyl)borinic acid has a molecular weight of 136.95 g/mol, XLogP of -0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-4-pyridinyl)borinic acid is sourced from PubChem (CID 143871240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).