C14H17NO2 — CID 174791067
2,4-dimethoxypyridine;toluene (PubChem CID 174791067) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2,4-dimethoxypyridine;toluene.
| Compound Name | 2,4-dimethoxypyridine;toluene |
|---|---|
| PubChem CID | 174791067 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2,4-dimethoxypyridine;toluene |
| SMILES | COc1ccnc(OC)c1.Cc1ccccc1 |
| InChI | InChI=1S/C7H9NO2.C7H8/c1-9-6-3-4-8-7(5-6)10-2;1-7-5-3-2-4-6-7/h3-5H,1-2H3;2-6H,1H3 |
| InChIKey | YBSMOVHBKKVZFQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |