C20H26N2O — CID 143872763
ethane;N-(6-methyl-2-pyridinyl)-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]cyclopropane-1-carboxamide (PubChem CID 143872763) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is ethane;N-(6-methyl-2-pyridinyl)-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]cyclopropane-1-carboxamide.
| Compound Name | ethane;N-(6-methyl-2-pyridinyl)-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143872763 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | ethane;N-(6-methyl-2-pyridinyl)-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]cyclopropane-1-carboxamide |
| SMILES | C=C/C=C\C(=C/C=C)C1(C(=O)Nc2cccc(C)n2)CC1.CC |
| InChI | InChI=1S/C18H20N2O.C2H6/c1-4-6-10-15(8-5-2)18(12-13-18)17(21)20-16-11-7-9-14(3)19-16;1-2/h4-11H,1-2,12-13H2,3H3,(H,19,20,21);1-2H3/b10-6-,15-8+; |
| InChIKey | CRERZXYJAAKHIL-RQLATZMVSA-N |
| XLogP | 4.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|