C27H25N5O3S — CID 143874417
4-[[(4-cyanophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]benzamide (PubChem CID 143874417) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 4-[[(4-cyanophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]benzamide.
| Compound Name | 4-[[(4-cyanophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]benzamide |
|---|---|
| PubChem CID | 143874417 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 4-[[(4-cyanophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]-N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]benzamide |
| SMILES | C=C/C=C(/CNC(=O)c1ccc(CN(Cc2ccccn2)S(=O)(=O)c2ccc(C#N)cc2)cc1)N=C |
| InChI | InChI=1S/C27H25N5O3S/c1-3-6-24(29-2)18-31-27(33)23-12-8-22(9-13-23)19-32(20-25-7-4-5-16-30-25)36(34,35)26-14-10-21(17-28)11-15-26/h3-16H,1-2,18-20H2,(H,31,33)/b24-6- |
| InChIKey | PPQCRHVPVWJOMI-UMDHDWCXSA-N |
| XLogP | 3.84 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|