C11H13NO3 — CID 143874710
methyl 6-[(E)-3-oxobut-1-enyl]-1,4-dihydropyridine-2-carboxylate (PubChem CID 143874710) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 6-[(E)-3-oxobut-1-enyl]-1,4-dihydropyridine-2-carboxylate.
| Compound Name | methyl 6-[(E)-3-oxobut-1-enyl]-1,4-dihydropyridine-2-carboxylate |
|---|---|
| PubChem CID | 143874710 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | methyl 6-[(E)-3-oxobut-1-enyl]-1,4-dihydropyridine-2-carboxylate |
| SMILES | COC(=O)C1=CCC=C(/C=C/C(C)=O)N1 |
| InChI | InChI=1S/C11H13NO3/c1-8(13)6-7-9-4-3-5-10(12-9)11(14)15-2/h4-7,12H,3H2,1-2H3/b7-6+ |
| InChIKey | BIZFNEGJOMVZCZ-VOTSOKGWSA-N |
| XLogP | 1.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|