C17H16N2O4S — CID 143876568
7-ethoxy-5-[(6-methylsulfanyl-3-pyridinyl)oxy]-1H-indole-2-carboxylic acid (PubChem CID 143876568) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 7-ethoxy-5-[(6-methylsulfanyl-3-pyridinyl)oxy]-1H-indole-2-carboxylic acid.
| Compound Name | 7-ethoxy-5-[(6-methylsulfanyl-3-pyridinyl)oxy]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 143876568 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 7-ethoxy-5-[(6-methylsulfanyl-3-pyridinyl)oxy]-1H-indole-2-carboxylic acid |
| SMILES | CCOc1cc(Oc2ccc(SC)nc2)cc2cc(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C17H16N2O4S/c1-3-22-14-8-12(23-11-4-5-15(24-2)18-9-11)6-10-7-13(17(20)21)19-16(10)14/h4-9,19H,3H2,1-2H3,(H,20,21) |
| InChIKey | AEIHASMHSNVWIM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |