About ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide
ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide (PubChem CID 157325314) has the molecular formula C21H23NO6S
and a molecular weight of 417.48 g/mol. Its IUPAC name is ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide.
Molecular Properties
| Compound Name | ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide |
| PubChem CID | 157325314 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide |
| SMILES | CCOC(=O)c1cc2cc(Oc3ccc(C)cc3)cc(OC(C)C)c2[nH]1.O=S=O |
| InChI | InChI=1S/C21H23NO4.O2S/c1-5-24-21(23)18-11-15-10-17(26-16-8-6-14(4)7-9-16)12-19(20(15)22-18)25-13(2)3;1-3-2/h6-13,22H,5H2,1-4H3; |
| InChIKey | BEQMIFBQCCTCRC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide?
The IUPAC name of ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide (CID 157325314) is ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide.
What is the SMILES notation for ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide?
The canonical SMILES for ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide is CCOC(=O)c1cc2cc(Oc3ccc(C)cc3)cc(OC(C)C)c2[nH]1.O=S=O.
What is the InChIKey of ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide?
The InChIKey is BEQMIFBQCCTCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4.O2S/c1-5-24-21(23)18-11-15-10-17(26-16-8-6-14(4)7-9-16)12-19(20(15)22-18)25-13(2)3;1-3-2/h6-13,22H,5H2,1-4H3;.
What are the key properties of ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide?
ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide has a molecular weight of 417.48 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(4-methylphenoxy)-7-propan-2-yloxy-1H-indole-2-carboxylate;sulfur dioxide is sourced from PubChem (CID 157325314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).