C27H25N3O8S — CID 161425003
ethyl 2-[2-[5-(4-methylphenoxy)-7-phenylmethoxy-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetate;sulfur dioxide (PubChem CID 161425003) has the molecular formula C27H25N3O8S and a molecular weight of 551.58 g/mol. Its IUPAC name is ethyl 2-[2-[5-(4-methylphenoxy)-7-phenylmethoxy-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetate;sulfur dioxide.
| Compound Name | ethyl 2-[2-[5-(4-methylphenoxy)-7-phenylmethoxy-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetate;sulfur dioxide |
|---|---|
| PubChem CID | 161425003 |
| Molecular Formula | C27H25N3O8S |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | ethyl 2-[2-[5-(4-methylphenoxy)-7-phenylmethoxy-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetate;sulfur dioxide |
| SMILES | CCOC(=O)C(=O)NNC(=O)c1cc2cc(Oc3ccc(C)cc3)cc(OCc3ccccc3)c2[nH]1.O=S=O |
| InChI | InChI=1S/C27H25N3O6.O2S/c1-3-34-27(33)26(32)30-29-25(31)22-14-19-13-21(36-20-11-9-17(2)10-12-20)15-23(24(19)28-22)35-16-18-7-5-4-6-8-18;1-3-2/h4-15,28H,3,16H2,1-2H3,(H,29,31)(H,30,32); |
| InChIKey | VXFXPXCIRNIVJH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|