C25H21N3O8S — CID 90002127
2-[2-[5-(4-methylsulfonylphenoxy)-7-phenylmethoxy-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetic acid (PubChem CID 90002127) has the molecular formula C25H21N3O8S and a molecular weight of 523.52 g/mol. Its IUPAC name is 2-[2-[5-(4-methylsulfonylphenoxy)-7-phenylmethoxy-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetic acid.
| Compound Name | 2-[2-[5-(4-methylsulfonylphenoxy)-7-phenylmethoxy-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 90002127 |
| Molecular Formula | C25H21N3O8S |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 2-[2-[5-(4-methylsulfonylphenoxy)-7-phenylmethoxy-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetic acid |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc(OCc3ccccc3)c3[nH]c(C(=O)NNC(=O)C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C25H21N3O8S/c1-37(33,34)19-9-7-17(8-10-19)36-18-11-16-12-20(23(29)27-28-24(30)25(31)32)26-22(16)21(13-18)35-14-15-5-3-2-4-6-15/h2-13,26H,14H2,1H3,(H,27,29)(H,28,30)(H,31,32) |
| InChIKey | TWUJUNMEBGANOO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 163.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|