C32H32N2O8S — CID 11467559
2-[4-phenylmethoxy-2-[(5,6,7-trimethoxy-1H-indole-2-carbonyl)amino]naphthalen-1-yl]ethyl methanesulfonate (PubChem CID 11467559) has the molecular formula C32H32N2O8S and a molecular weight of 604.68 g/mol. Its IUPAC name is 2-[4-phenylmethoxy-2-[(5,6,7-trimethoxy-1H-indole-2-carbonyl)amino]naphthalen-1-yl]ethyl methanesulfonate.
| Compound Name | 2-[4-phenylmethoxy-2-[(5,6,7-trimethoxy-1H-indole-2-carbonyl)amino]naphthalen-1-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 11467559 |
| Molecular Formula | C32H32N2O8S |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 2-[4-phenylmethoxy-2-[(5,6,7-trimethoxy-1H-indole-2-carbonyl)amino]naphthalen-1-yl]ethyl methanesulfonate |
| SMILES | COc1cc2cc(C(=O)Nc3cc(OCc4ccccc4)c4ccccc4c3CCOS(C)(=O)=O)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C32H32N2O8S/c1-38-28-17-21-16-26(33-29(21)31(40-3)30(28)39-2)32(35)34-25-18-27(41-19-20-10-6-5-7-11-20)24-13-9-8-12-22(24)23(25)14-15-42-43(4,36)37/h5-13,16-18,33H,14-15,19H2,1-4H3,(H,34,35) |
| InChIKey | KILKDEYDEDPZQK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|