C27H27ClN2O4 — CID 141049186
N-[5-benzyl-2-(2-chloroethyl)phenyl]-5,6,7-trimethoxy-1H-indole-2-carboxamide (PubChem CID 141049186) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is N-[5-benzyl-2-(2-chloroethyl)phenyl]-5,6,7-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[5-benzyl-2-(2-chloroethyl)phenyl]-5,6,7-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 141049186 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[5-benzyl-2-(2-chloroethyl)phenyl]-5,6,7-trimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)Nc3cc(Cc4ccccc4)ccc3CCCl)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C27H27ClN2O4/c1-32-23-16-20-15-22(29-24(20)26(34-3)25(23)33-2)27(31)30-21-14-18(9-10-19(21)11-12-28)13-17-7-5-4-6-8-17/h4-10,14-16,29H,11-13H2,1-3H3,(H,30,31) |
| InChIKey | VNCBEZSDDCHLFS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|