C23H20N2O4S2 — CID 86652857
5-(4-methylsulfonylphenoxy)-7-phenylmethoxy-1H-indole-2-carbothioamide (PubChem CID 86652857) has the molecular formula C23H20N2O4S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenoxy)-7-phenylmethoxy-1H-indole-2-carbothioamide.
| Compound Name | 5-(4-methylsulfonylphenoxy)-7-phenylmethoxy-1H-indole-2-carbothioamide |
|---|---|
| PubChem CID | 86652857 |
| Molecular Formula | C23H20N2O4S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 5-(4-methylsulfonylphenoxy)-7-phenylmethoxy-1H-indole-2-carbothioamide |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc(OCc3ccccc3)c3[nH]c(C(N)=S)cc3c2)cc1 |
| InChI | InChI=1S/C23H20N2O4S2/c1-31(26,27)19-9-7-17(8-10-19)29-18-11-16-12-20(23(24)30)25-22(16)21(13-18)28-14-15-5-3-2-4-6-15/h2-13,25H,14H2,1H3,(H2,24,30) |
| InChIKey | NEKHBZYYGPIKQP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|