C26H26O5 — CID 162742859
ethyl 4-[5-(4-methylphenoxy)-2-phenylmethoxyphenyl]-4-oxobutanoate (PubChem CID 162742859) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is ethyl 4-[5-(4-methylphenoxy)-2-phenylmethoxyphenyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[5-(4-methylphenoxy)-2-phenylmethoxyphenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162742859 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | ethyl 4-[5-(4-methylphenoxy)-2-phenylmethoxyphenyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1cc(Oc2ccc(C)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H26O5/c1-3-29-26(28)16-14-24(27)23-17-22(31-21-11-9-19(2)10-12-21)13-15-25(23)30-18-20-7-5-4-6-8-20/h4-13,15,17H,3,14,16,18H2,1-2H3 |
| InChIKey | DWPGZTQQPLYTLO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |