C20H21BrO4 — CID 162742853
ethyl 4-[3-bromo-2-hydroxy-5-(2-phenylethyl)phenyl]-4-oxobutanoate (PubChem CID 162742853) has the molecular formula C20H21BrO4 and a molecular weight of 405.29 g/mol. Its IUPAC name is ethyl 4-[3-bromo-2-hydroxy-5-(2-phenylethyl)phenyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[3-bromo-2-hydroxy-5-(2-phenylethyl)phenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162742853 |
| Molecular Formula | C20H21BrO4 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | ethyl 4-[3-bromo-2-hydroxy-5-(2-phenylethyl)phenyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1cc(CCc2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C20H21BrO4/c1-2-25-19(23)11-10-18(22)16-12-15(13-17(21)20(16)24)9-8-14-6-4-3-5-7-14/h3-7,12-13,24H,2,8-11H2,1H3 |
| InChIKey | OQIICJXDXLYEQJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |