C18H16BrClO4 — CID 162742764
ethyl 4-[3-bromo-5-(3-chlorophenyl)-2-hydroxyphenyl]-4-oxobutanoate (PubChem CID 162742764) has the molecular formula C18H16BrClO4 and a molecular weight of 411.68 g/mol. Its IUPAC name is ethyl 4-[3-bromo-5-(3-chlorophenyl)-2-hydroxyphenyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[3-bromo-5-(3-chlorophenyl)-2-hydroxyphenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162742764 |
| Molecular Formula | C18H16BrClO4 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | ethyl 4-[3-bromo-5-(3-chlorophenyl)-2-hydroxyphenyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1cc(-c2cccc(Cl)c2)cc(Br)c1O |
| InChI | InChI=1S/C18H16BrClO4/c1-2-24-17(22)7-6-16(21)14-9-12(10-15(19)18(14)23)11-4-3-5-13(20)8-11/h3-5,8-10,23H,2,6-7H2,1H3 |
| InChIKey | TYLACJFVSBYPCM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |