C21H18ClNO4 — CID 167492046
ethyl 4-[7-(3-chlorophenyl)-3-hydroxyquinolin-2-yl]-4-oxobutanoate (PubChem CID 167492046) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is ethyl 4-[7-(3-chlorophenyl)-3-hydroxyquinolin-2-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[7-(3-chlorophenyl)-3-hydroxyquinolin-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 167492046 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | ethyl 4-[7-(3-chlorophenyl)-3-hydroxyquinolin-2-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc2cc(-c3cccc(Cl)c3)ccc2cc1O |
| InChI | InChI=1S/C21H18ClNO4/c1-2-27-20(26)9-8-18(24)21-19(25)12-15-7-6-14(11-17(15)23-21)13-4-3-5-16(22)10-13/h3-7,10-12,25H,2,8-9H2,1H3 |
| InChIKey | WQGVIHXQEIXYBF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |