C19H21NO4 — CID 162742936
ethyl 4-[3-hydroxy-6-[(3-methylphenyl)methyl]-2-pyridinyl]-4-oxobutanoate (PubChem CID 162742936) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 4-[3-hydroxy-6-[(3-methylphenyl)methyl]-2-pyridinyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[3-hydroxy-6-[(3-methylphenyl)methyl]-2-pyridinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162742936 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | ethyl 4-[3-hydroxy-6-[(3-methylphenyl)methyl]-2-pyridinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc(Cc2cccc(C)c2)ccc1O |
| InChI | InChI=1S/C19H21NO4/c1-3-24-18(23)10-9-17(22)19-16(21)8-7-15(20-19)12-14-6-4-5-13(2)11-14/h4-8,11,21H,3,9-10,12H2,1-2H3 |
| InChIKey | HKAUJYQMLVOGEW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |