C26H24N2O4 — CID 162742775
ethyl 4-[6-[(2-benzylphenyl)methyl]-4-cyano-3-hydroxy-2-pyridinyl]-4-oxobutanoate (PubChem CID 162742775) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is ethyl 4-[6-[(2-benzylphenyl)methyl]-4-cyano-3-hydroxy-2-pyridinyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[6-[(2-benzylphenyl)methyl]-4-cyano-3-hydroxy-2-pyridinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162742775 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | ethyl 4-[6-[(2-benzylphenyl)methyl]-4-cyano-3-hydroxy-2-pyridinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc(Cc2ccccc2Cc2ccccc2)cc(C#N)c1O |
| InChI | InChI=1S/C26H24N2O4/c1-2-32-24(30)13-12-23(29)25-26(31)21(17-27)16-22(28-25)15-20-11-7-6-10-19(20)14-18-8-4-3-5-9-18/h3-11,16,31H,2,12-15H2,1H3 |
| InChIKey | CHUMECRITMZIOK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |