C19H17ClN2O4 — CID 162743055
ethyl 4-[6-(2-chloro-4-methylphenyl)-4-cyano-3-hydroxy-2-pyridinyl]-4-oxobutanoate (PubChem CID 162743055) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is ethyl 4-[6-(2-chloro-4-methylphenyl)-4-cyano-3-hydroxy-2-pyridinyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[6-(2-chloro-4-methylphenyl)-4-cyano-3-hydroxy-2-pyridinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162743055 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | ethyl 4-[6-(2-chloro-4-methylphenyl)-4-cyano-3-hydroxy-2-pyridinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc(-c2ccc(C)cc2Cl)cc(C#N)c1O |
| InChI | InChI=1S/C19H17ClN2O4/c1-3-26-17(24)7-6-16(23)18-19(25)12(10-21)9-15(22-18)13-5-4-11(2)8-14(13)20/h4-5,8-9,25H,3,6-7H2,1-2H3 |
| InChIKey | MODOHNBFJIDVSL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |