C23H20N2O5 — CID 167491759
ethyl 4-[4-cyano-3-hydroxy-8-(3-methoxyphenyl)quinolin-2-yl]-4-oxobutanoate (PubChem CID 167491759) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is ethyl 4-[4-cyano-3-hydroxy-8-(3-methoxyphenyl)quinolin-2-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-cyano-3-hydroxy-8-(3-methoxyphenyl)quinolin-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 167491759 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | ethyl 4-[4-cyano-3-hydroxy-8-(3-methoxyphenyl)quinolin-2-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc2c(-c3cccc(OC)c3)cccc2c(C#N)c1O |
| InChI | InChI=1S/C23H20N2O5/c1-3-30-20(27)11-10-19(26)22-23(28)18(13-24)17-9-5-8-16(21(17)25-22)14-6-4-7-15(12-14)29-2/h4-9,12,28H,3,10-11H2,1-2H3 |
| InChIKey | ILPBRUDQQODSPS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |