C19H15F3N2O4 — CID 162742976
ethyl 4-[4-cyano-3-hydroxy-6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]-4-oxobutanoate (PubChem CID 162742976) has the molecular formula C19H15F3N2O4 and a molecular weight of 392.33 g/mol. Its IUPAC name is ethyl 4-[4-cyano-3-hydroxy-6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-cyano-3-hydroxy-6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162742976 |
| Molecular Formula | C19H15F3N2O4 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | ethyl 4-[4-cyano-3-hydroxy-6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc(-c2cccc(C(F)(F)F)c2)cc(C#N)c1O |
| InChI | InChI=1S/C19H15F3N2O4/c1-2-28-16(26)7-6-15(25)17-18(27)12(10-23)9-14(24-17)11-4-3-5-13(8-11)19(20,21)22/h3-5,8-9,27H,2,6-7H2,1H3 |
| InChIKey | XLZRFRILFVKUII-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |