C16H14N2O4 — CID 167492071
ethyl 4-(5-cyano-3-hydroxyquinolin-2-yl)-4-oxobutanoate (PubChem CID 167492071) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is ethyl 4-(5-cyano-3-hydroxyquinolin-2-yl)-4-oxobutanoate.
| Compound Name | ethyl 4-(5-cyano-3-hydroxyquinolin-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 167492071 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | ethyl 4-(5-cyano-3-hydroxyquinolin-2-yl)-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc2cccc(C#N)c2cc1O |
| InChI | InChI=1S/C16H14N2O4/c1-2-22-15(21)7-6-13(19)16-14(20)8-11-10(9-17)4-3-5-12(11)18-16/h3-5,8,20H,2,6-7H2,1H3 |
| InChIKey | RIZFQDRYQOQMID-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |