C21H17BrClNO4 — CID 167492159
ethyl 4-[4-bromo-8-(3-chlorophenyl)-3-hydroxyquinolin-2-yl]-4-oxobutanoate (PubChem CID 167492159) has the molecular formula C21H17BrClNO4 and a molecular weight of 462.73 g/mol. Its IUPAC name is ethyl 4-[4-bromo-8-(3-chlorophenyl)-3-hydroxyquinolin-2-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-bromo-8-(3-chlorophenyl)-3-hydroxyquinolin-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 167492159 |
| Molecular Formula | C21H17BrClNO4 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | ethyl 4-[4-bromo-8-(3-chlorophenyl)-3-hydroxyquinolin-2-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc2c(-c3cccc(Cl)c3)cccc2c(Br)c1O |
| InChI | InChI=1S/C21H17BrClNO4/c1-2-28-17(26)10-9-16(25)20-21(27)18(22)15-8-4-7-14(19(15)24-20)12-5-3-6-13(23)11-12/h3-8,11,27H,2,9-10H2,1H3 |
| InChIKey | DRCHZNQNUXYUQB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |