About 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid
4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid (PubChem CID 162742435) has the molecular formula C20H17N3O4
and a molecular weight of 363.37 g/mol. Its IUPAC name is 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid |
| PubChem CID | 162742435 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid |
| SMILES | Cc1cc(C#N)cc(C)c1Cc1cc(C#N)c(O)c(C(=O)CCC(=O)O)n1 |
| InChI | InChI=1S/C20H17N3O4/c1-11-5-13(9-21)6-12(2)16(11)8-15-7-14(10-22)20(27)19(23-15)17(24)3-4-18(25)26/h5-7,27H,3-4,8H2,1-2H3,(H,25,26) |
| InChIKey | ICFGREKYQQUDNK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid?
The IUPAC name of 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid (CID 162742435) is 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid.
What is the SMILES notation for 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid?
The canonical SMILES for 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid is Cc1cc(C#N)cc(C)c1Cc1cc(C#N)c(O)c(C(=O)CCC(=O)O)n1.
What is the InChIKey of 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid?
The InChIKey is ICFGREKYQQUDNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O4/c1-11-5-13(9-21)6-12(2)16(11)8-15-7-14(10-22)20(27)19(23-15)17(24)3-4-18(25)26/h5-7,27H,3-4,8H2,1-2H3,(H,25,26).
What are the key properties of 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid?
4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid has a molecular weight of 363.37 g/mol, XLogP of 2.79, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-cyano-6-[(4-cyano-2,6-dimethylphenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoic acid is sourced from PubChem (CID 162742435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).