C18H18FNO4 — CID 162742849
ethyl 4-[6-[(3-fluorophenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoate (PubChem CID 162742849) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is ethyl 4-[6-[(3-fluorophenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[6-[(3-fluorophenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162742849 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | ethyl 4-[6-[(3-fluorophenyl)methyl]-3-hydroxy-2-pyridinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1nc(Cc2cccc(F)c2)ccc1O |
| InChI | InChI=1S/C18H18FNO4/c1-2-24-17(23)9-8-16(22)18-15(21)7-6-14(20-18)11-12-4-3-5-13(19)10-12/h3-7,10,21H,2,8-9,11H2,1H3 |
| InChIKey | SFAJWMCPBMTZGQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |