C25H23ClO5 — CID 162742813
ethyl 4-[5-(2-chlorophenoxy)-2-phenylmethoxyphenyl]-4-oxobutanoate (PubChem CID 162742813) has the molecular formula C25H23ClO5 and a molecular weight of 438.91 g/mol. Its IUPAC name is ethyl 4-[5-(2-chlorophenoxy)-2-phenylmethoxyphenyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[5-(2-chlorophenoxy)-2-phenylmethoxyphenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162742813 |
| Molecular Formula | C25H23ClO5 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | ethyl 4-[5-(2-chlorophenoxy)-2-phenylmethoxyphenyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1cc(Oc2ccccc2Cl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H23ClO5/c1-2-29-25(28)15-13-22(27)20-16-19(31-24-11-7-6-10-21(24)26)12-14-23(20)30-17-18-8-4-3-5-9-18/h3-12,14,16H,2,13,15,17H2,1H3 |
| InChIKey | RFWIUDYAZJRVIW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |