C22H28F2N4O4 — CID 143878542
N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-(2,5-difluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide (PubChem CID 143878542) has the molecular formula C22H28F2N4O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-(2,5-difluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide.
| Compound Name | N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-(2,5-difluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 143878542 |
| Molecular Formula | C22H28F2N4O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-(2,5-difluorophenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)/N=C(N)/C=C\NCCCO)N1CC(Oc2cc(F)ccc2F)=CC1=O |
| InChI | InChI=1S/C22H28F2N4O4/c1-14(2)10-18(22(31)27-20(25)6-8-26-7-3-9-29)28-13-16(12-21(28)30)32-19-11-15(23)4-5-17(19)24/h4-6,8,11-12,14,18,26,29H,3,7,9-10,13H2,1-2H3,(H2,25,27,31)/b8-6- |
| InChIKey | MWNHJLWLDYUTRF-VURMDHGXSA-N |
| XLogP | 1.85 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|