C14H24N2O3 — CID 143878743
tert-butyl (3R)-3-(3-methyl-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate (PubChem CID 143878743) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is tert-butyl (3R)-3-(3-methyl-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(3-methyl-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143878743 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | tert-butyl (3R)-3-(3-methyl-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CC1CCN([C@@H]2CCN(C(=O)OC(C)(C)C)C2)C1=O |
| InChI | InChI=1S/C14H24N2O3/c1-10-5-8-16(12(10)17)11-6-7-15(9-11)13(18)19-14(2,3)4/h10-11H,5-9H2,1-4H3/t10?,11-/m1/s1 |
| InChIKey | CLIMNKHCKHNFOR-RRKGBCIJSA-N |
| XLogP | 1.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |