C19H32N2O4 — CID 143883059
1-(3-methylidenecyclohexyl)ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1-carboxylate (PubChem CID 143883059) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-(3-methylidenecyclohexyl)ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1-carboxylate.
| Compound Name | 1-(3-methylidenecyclohexyl)ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143883059 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-(3-methylidenecyclohexyl)ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1-carboxylate |
| SMILES | C=C1CCCC(C(C)OC(=O)N2CCC(NC(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C19H32N2O4/c1-13-7-6-8-15(11-13)14(2)24-18(23)21-10-9-16(12-21)20-17(22)25-19(3,4)5/h14-16H,1,6-12H2,2-5H3,(H,20,22) |
| InChIKey | VTCJENSFEGQPGF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|