C22H24ClN7O2 — CID 143884540
1-(6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-[2-(methoxyamino)ethyl]urea (PubChem CID 143884540) has the molecular formula C22H24ClN7O2 and a molecular weight of 453.93 g/mol. Its IUPAC name is 1-(6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-[2-(methoxyamino)ethyl]urea.
| Compound Name | 1-(6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-[2-(methoxyamino)ethyl]urea |
|---|---|
| PubChem CID | 143884540 |
| Molecular Formula | C22H24ClN7O2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 1-(6-chloro-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-[2-(methoxyamino)ethyl]urea |
| SMILES | CONCCNC(=O)Nc1ccc2cc1CCc1cccc(c1)Nc1ncc(Cl)c(n1)N2 |
| InChI | InChI=1S/C22H24ClN7O2/c1-32-26-10-9-24-22(31)29-19-8-7-17-12-15(19)6-5-14-3-2-4-16(11-14)28-21-25-13-18(23)20(27-17)30-21/h2-4,7-8,11-13,26H,5-6,9-10H2,1H3,(H2,24,29,31)(H2,25,27,28,30) |
| InChIKey | DETVCOKGTHQPFI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|