C21H30FN3O2 — CID 143885628
(2'R,8aS)-2'-(4-fluoro-2-methylphenyl)-N,8a-dimethylspiro[3,4,7,8-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,4'-piperidine]-1'-carboxamide (PubChem CID 143885628) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is (2'R,8aS)-2'-(4-fluoro-2-methylphenyl)-N,8a-dimethylspiro[3,4,7,8-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,4'-piperidine]-1'-carboxamide.
| Compound Name | (2'R,8aS)-2'-(4-fluoro-2-methylphenyl)-N,8a-dimethylspiro[3,4,7,8-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 143885628 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (2'R,8aS)-2'-(4-fluoro-2-methylphenyl)-N,8a-dimethylspiro[3,4,7,8-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,4'-piperidine]-1'-carboxamide |
| SMILES | CNC(=O)N1CCC2(CC[C@@]3(C)COCCN23)C[C@@H]1c1ccc(F)cc1C |
| InChI | InChI=1S/C21H30FN3O2/c1-15-12-16(22)4-5-17(15)18-13-21(8-9-24(18)19(26)23-3)7-6-20(2)14-27-11-10-25(20)21/h4-5,12,18H,6-11,13-14H2,1-3H3,(H,23,26)/t18-,20+,21?/m1/s1 |
| InChIKey | NZIAIWCLTQWJNI-LGWYJFNUSA-N |
| XLogP | 3.23 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |