C25H32N2O5S — CID 143885744
1-[4-(3-morpholin-4-ylpropyl)-3-morpholin-4-ylsulfonylphenyl]-2-phenylethanone (PubChem CID 143885744) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is 1-[4-(3-morpholin-4-ylpropyl)-3-morpholin-4-ylsulfonylphenyl]-2-phenylethanone.
| Compound Name | 1-[4-(3-morpholin-4-ylpropyl)-3-morpholin-4-ylsulfonylphenyl]-2-phenylethanone |
|---|---|
| PubChem CID | 143885744 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-[4-(3-morpholin-4-ylpropyl)-3-morpholin-4-ylsulfonylphenyl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)c1ccc(CCCN2CCOCC2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H32N2O5S/c28-24(19-21-5-2-1-3-6-21)23-9-8-22(7-4-10-26-11-15-31-16-12-26)25(20-23)33(29,30)27-13-17-32-18-14-27/h1-3,5-6,8-9,20H,4,7,10-19H2 |
| InChIKey | PKYSCWOAXMGJCO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |