C8H13NO7S — CID 143888024
4-[[(Z)-3-hydroxyprop-2-enoyl]-methylamino]-3-sulfobutanoic acid (PubChem CID 143888024) has the molecular formula C8H13NO7S and a molecular weight of 267.26 g/mol. Its IUPAC name is 4-[[(Z)-3-hydroxyprop-2-enoyl]-methylamino]-3-sulfobutanoic acid.
| Compound Name | 4-[[(Z)-3-hydroxyprop-2-enoyl]-methylamino]-3-sulfobutanoic acid |
|---|---|
| PubChem CID | 143888024 |
| Molecular Formula | C8H13NO7S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-[[(Z)-3-hydroxyprop-2-enoyl]-methylamino]-3-sulfobutanoic acid |
| SMILES | CN(CC(CC(=O)O)S(=O)(=O)O)C(=O)/C=C\O |
| InChI | InChI=1S/C8H13NO7S/c1-9(7(11)2-3-10)5-6(4-8(12)13)17(14,15)16/h2-3,6,10H,4-5H2,1H3,(H,12,13)(H,14,15,16)/b3-2- |
| InChIKey | GJBDWIQQXKPVJH-IHWYPQMZSA-N |
| XLogP | -0.75 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|