C6H16N2O6S — CID 87301928
3-(2,2-dimethylhydrazinyl)butanoic acid;sulfuric acid (PubChem CID 87301928) has the molecular formula C6H16N2O6S and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-(2,2-dimethylhydrazinyl)butanoic acid;sulfuric acid.
| Compound Name | 3-(2,2-dimethylhydrazinyl)butanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 87301928 |
| Molecular Formula | C6H16N2O6S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-(2,2-dimethylhydrazinyl)butanoic acid;sulfuric acid |
| SMILES | CC(CC(=O)O)NN(C)C.O=S(=O)(O)O |
| InChI | InChI=1S/C6H14N2O2.H2O4S/c1-5(4-6(9)10)7-8(2)3;1-5(2,3)4/h5,7H,4H2,1-3H3,(H,9,10);(H2,1,2,3,4) |
| InChIKey | ORWWILOQYCMQNE-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|