C24H30N4O2 — CID 143888366
1-aminoethyl 7-[3-(3-methoxyquinoxalin-2-yl)phenyl]heptanimidate (PubChem CID 143888366) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-aminoethyl 7-[3-(3-methoxyquinoxalin-2-yl)phenyl]heptanimidate.
| Compound Name | 1-aminoethyl 7-[3-(3-methoxyquinoxalin-2-yl)phenyl]heptanimidate |
|---|---|
| PubChem CID | 143888366 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-aminoethyl 7-[3-(3-methoxyquinoxalin-2-yl)phenyl]heptanimidate |
| SMILES | [H]/N=C(/CCCCCCc1cccc(-c2nc3ccccc3nc2OC)c1)OC(C)N |
| InChI | InChI=1S/C24H30N4O2/c1-17(25)30-22(26)15-6-4-3-5-10-18-11-9-12-19(16-18)23-24(29-2)28-21-14-8-7-13-20(21)27-23/h7-9,11-14,16-17,26H,3-6,10,15,25H2,1-2H3/b26-22- |
| InChIKey | KGMODJNYUSTOQD-ROMGYVFFSA-N |
| XLogP | 5.10 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|