C14H11N3O2 — CID 143888685
8-nitroso-6-pyridin-3-yl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 143888685) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 8-nitroso-6-pyridin-3-yl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-nitroso-6-pyridin-3-yl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 143888685 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 8-nitroso-6-pyridin-3-yl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=Nc1cc(-c2cccnc2)cc2c1NC(=O)CC2 |
| InChI | InChI=1S/C14H11N3O2/c18-13-4-3-9-6-11(10-2-1-5-15-8-10)7-12(17-19)14(9)16-13/h1-2,5-8H,3-4H2,(H,16,18) |
| InChIKey | DOCTYVOEEKBBPM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |