C17H18N2O — CID 143888757
N-(9-pyridin-3-yl-11-bicyclo[5.3.1]undeca-1(10),7(11),8-trienyl)formamide (PubChem CID 143888757) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(9-pyridin-3-yl-11-bicyclo[5.3.1]undeca-1(10),7(11),8-trienyl)formamide.
| Compound Name | N-(9-pyridin-3-yl-11-bicyclo[5.3.1]undeca-1(10),7(11),8-trienyl)formamide |
|---|---|
| PubChem CID | 143888757 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-(9-pyridin-3-yl-11-bicyclo[5.3.1]undeca-1(10),7(11),8-trienyl)formamide |
| SMILES | O=CNc1c2cc(-c3cccnc3)cc1CCCCC2 |
| InChI | InChI=1S/C17H18N2O/c20-12-19-17-13-5-2-1-3-6-14(17)10-16(9-13)15-7-4-8-18-11-15/h4,7-12H,1-3,5-6H2,(H,19,20) |
| InChIKey | ZGWQXVJWGFPEHU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|