C20H26N2+2 — CID 143888878
1-[(E)-but-1-enyl]-4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]pyridin-1-ium (PubChem CID 143888878) has the molecular formula C20H26N2+2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]pyridin-1-ium.
| Compound Name | 1-[(E)-but-1-enyl]-4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 143888878 |
| Molecular Formula | C20H26N2+2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[(E)-but-1-enyl]-4-[(E)-2-(1-butylpyridin-1-ium-4-yl)ethenyl]pyridin-1-ium |
| SMILES | CC/C=C/[n+]1ccc(/C=C/c2cc[n+](CCCC)cc2)cc1 |
| InChI | InChI=1S/C20H26N2/c1-3-5-13-21-15-9-19(10-16-21)7-8-20-11-17-22(18-12-20)14-6-4-2/h5,7-13,15-18H,3-4,6,14H2,1-2H3/q+2/b8-7+,13-5+ |
| InChIKey | SBSKWMMHTJRODK-BGJIPISASA-N |
| XLogP | 4.11 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|