C23H38F2O3 — CID 143889250
2-[[(6Z,8Z)-6-ethyl-7,8-difluoro-9-methoxy-5-methyldeca-6,8-dien-2-yl]oxymethyl]-5-[(E)-prop-1-enyl]oxane (PubChem CID 143889250) has the molecular formula C23H38F2O3 and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-[[(6Z,8Z)-6-ethyl-7,8-difluoro-9-methoxy-5-methyldeca-6,8-dien-2-yl]oxymethyl]-5-[(E)-prop-1-enyl]oxane.
| Compound Name | 2-[[(6Z,8Z)-6-ethyl-7,8-difluoro-9-methoxy-5-methyldeca-6,8-dien-2-yl]oxymethyl]-5-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 143889250 |
| Molecular Formula | C23H38F2O3 |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 2-[[(6Z,8Z)-6-ethyl-7,8-difluoro-9-methoxy-5-methyldeca-6,8-dien-2-yl]oxymethyl]-5-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(COC(C)CCC(C)/C(CC)=C(F)/C(F)=C(\C)OC)OC1 |
| InChI | InChI=1S/C23H38F2O3/c1-7-9-19-12-13-20(28-14-19)15-27-17(4)11-10-16(3)21(8-2)23(25)22(24)18(5)26-6/h7,9,16-17,19-20H,8,10-15H2,1-6H3/b9-7+,22-18-,23-21- |
| InChIKey | XHNHLMWHYRFUGR-ZTBYKOANSA-N |
| XLogP | 6.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|