C24H42F2O3 — CID 143889305
2-butyl-5-[(6Z,8Z)-6-ethyl-7,8-difluoro-9-methoxy-2,5-dimethyldeca-6,8-dienoxy]oxane (PubChem CID 143889305) has the molecular formula C24H42F2O3 and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-butyl-5-[(6Z,8Z)-6-ethyl-7,8-difluoro-9-methoxy-2,5-dimethyldeca-6,8-dienoxy]oxane.
| Compound Name | 2-butyl-5-[(6Z,8Z)-6-ethyl-7,8-difluoro-9-methoxy-2,5-dimethyldeca-6,8-dienoxy]oxane |
|---|---|
| PubChem CID | 143889305 |
| Molecular Formula | C24H42F2O3 |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 2-butyl-5-[(6Z,8Z)-6-ethyl-7,8-difluoro-9-methoxy-2,5-dimethyldeca-6,8-dienoxy]oxane |
| SMILES | CCCCC1CCC(OCC(C)CCC(C)/C(CC)=C(F)/C(F)=C(\C)OC)CO1 |
| InChI | InChI=1S/C24H42F2O3/c1-7-9-10-20-13-14-21(16-29-20)28-15-17(3)11-12-18(4)22(8-2)24(26)23(25)19(5)27-6/h17-18,20-21H,7-16H2,1-6H3/b23-19-,24-22- |
| InChIKey | MBKQKLWQMSHISY-TVVONNRASA-N |
| XLogP | 7.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|