C24H42F2O3 — CID 143889259
1-butyl-4-[1-[(3Z,5Z)-3-ethyl-4,5-difluoro-6-methoxy-2-methylhepta-3,5-dienoxy]ethoxymethyl]cyclohexane (PubChem CID 143889259) has the molecular formula C24H42F2O3 and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-butyl-4-[1-[(3Z,5Z)-3-ethyl-4,5-difluoro-6-methoxy-2-methylhepta-3,5-dienoxy]ethoxymethyl]cyclohexane.
| Compound Name | 1-butyl-4-[1-[(3Z,5Z)-3-ethyl-4,5-difluoro-6-methoxy-2-methylhepta-3,5-dienoxy]ethoxymethyl]cyclohexane |
|---|---|
| PubChem CID | 143889259 |
| Molecular Formula | C24H42F2O3 |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 1-butyl-4-[1-[(3Z,5Z)-3-ethyl-4,5-difluoro-6-methoxy-2-methylhepta-3,5-dienoxy]ethoxymethyl]cyclohexane |
| SMILES | CCCCC1CCC(COC(C)OCC(C)/C(CC)=C(F)/C(F)=C(\C)OC)CC1 |
| InChI | InChI=1S/C24H42F2O3/c1-7-9-10-20-11-13-21(14-12-20)16-29-19(5)28-15-17(3)22(8-2)24(26)23(25)18(4)27-6/h17,19-21H,7-16H2,1-6H3/b23-18-,24-22- |
| InChIKey | PZKIAEMZHARHIY-ZOEVUZSCSA-N |
| XLogP | 7.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|