C23H42F2O3 — CID 143889397
1-[1-[(3Z,5Z)-4,5-difluoro-6-methoxy-2,3-dimethylhepta-3,5-dienoxy]ethoxymethyl]-4-ethylcyclohexane;ethane (PubChem CID 143889397) has the molecular formula C23H42F2O3 and a molecular weight of 404.58 g/mol. Its IUPAC name is 1-[1-[(3Z,5Z)-4,5-difluoro-6-methoxy-2,3-dimethylhepta-3,5-dienoxy]ethoxymethyl]-4-ethylcyclohexane;ethane.
| Compound Name | 1-[1-[(3Z,5Z)-4,5-difluoro-6-methoxy-2,3-dimethylhepta-3,5-dienoxy]ethoxymethyl]-4-ethylcyclohexane;ethane |
|---|---|
| PubChem CID | 143889397 |
| Molecular Formula | C23H42F2O3 |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | 1-[1-[(3Z,5Z)-4,5-difluoro-6-methoxy-2,3-dimethylhepta-3,5-dienoxy]ethoxymethyl]-4-ethylcyclohexane;ethane |
| SMILES | CC.CCC1CCC(COC(C)OCC(C)/C(C)=C(F)/C(F)=C(\C)OC)CC1 |
| InChI | InChI=1S/C21H36F2O3.C2H6/c1-7-18-8-10-19(11-9-18)13-26-17(5)25-12-14(2)15(3)20(22)21(23)16(4)24-6;1-2/h14,17-19H,7-13H2,1-6H3;1-2H3/b20-15-,21-16-; |
| InChIKey | CRBGLSTZCHCMED-LGHUCVCBSA-N |
| XLogP | 7.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|