C28H54F2O3 — CID 143889482
2-butyl-5-[[(6Z,8Z)-7,8-difluoro-9-methoxy-5,6-dimethyldeca-6,8-dien-2-yl]oxymethyl]oxane;ethane;propane (PubChem CID 143889482) has the molecular formula C28H54F2O3 and a molecular weight of 476.73 g/mol. Its IUPAC name is 2-butyl-5-[[(6Z,8Z)-7,8-difluoro-9-methoxy-5,6-dimethyldeca-6,8-dien-2-yl]oxymethyl]oxane;ethane;propane.
| Compound Name | 2-butyl-5-[[(6Z,8Z)-7,8-difluoro-9-methoxy-5,6-dimethyldeca-6,8-dien-2-yl]oxymethyl]oxane;ethane;propane |
|---|---|
| PubChem CID | 143889482 |
| Molecular Formula | C28H54F2O3 |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.40 |
| IUPAC Name | 2-butyl-5-[[(6Z,8Z)-7,8-difluoro-9-methoxy-5,6-dimethyldeca-6,8-dien-2-yl]oxymethyl]oxane;ethane;propane |
| SMILES | CC.CCC.CCCCC1CCC(COC(C)CCC(C)/C(C)=C(F)/C(F)=C(\C)OC)CO1 |
| InChI | InChI=1S/C23H40F2O3.C3H8.C2H6/c1-7-8-9-21-13-12-20(15-28-21)14-27-17(3)11-10-16(2)18(4)22(24)23(25)19(5)26-6;1-3-2;1-2/h16-17,20-21H,7-15H2,1-6H3;3H2,1-2H3;1-2H3/b22-18-,23-19-;; |
| InChIKey | YIRHQXQAXARTAV-SWSFOZEASA-N |
| XLogP | 9.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|