C25H38F2O3 — CID 143889740
2-[[4-[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl]oxymethyl]-5-pentyloxane (PubChem CID 143889740) has the molecular formula C25H38F2O3 and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-[[4-[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl]oxymethyl]-5-pentyloxane.
| Compound Name | 2-[[4-[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl]oxymethyl]-5-pentyloxane |
|---|---|
| PubChem CID | 143889740 |
| Molecular Formula | C25H38F2O3 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 2-[[4-[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl]oxymethyl]-5-pentyloxane |
| SMILES | CCCCCC1CCC(COC2=CC=C(/C(CC)=C(F)/C(F)=C(\C)OC)CC2)OC1 |
| InChI | InChI=1S/C25H38F2O3/c1-5-7-8-9-19-10-13-22(29-16-19)17-30-21-14-11-20(12-15-21)23(6-2)25(27)24(26)18(3)28-4/h11,14,19,22H,5-10,12-13,15-17H2,1-4H3/b24-18-,25-23- |
| InChIKey | KJSVIFFKFISCDC-UJNDXEQZSA-N |
| XLogP | 7.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|