C28H46F2O3 — CID 143889546
5-but-3-enyl-2-[[(3E,5E,7Z,9Z)-7-ethyl-8,9-difluoro-10-methoxy-6-methylundeca-3,5,7,9-tetraen-3-yl]oxymethyl]oxane;propane (PubChem CID 143889546) has the molecular formula C28H46F2O3 and a molecular weight of 468.67 g/mol. Its IUPAC name is 5-but-3-enyl-2-[[(3E,5E,7Z,9Z)-7-ethyl-8,9-difluoro-10-methoxy-6-methylundeca-3,5,7,9-tetraen-3-yl]oxymethyl]oxane;propane.
| Compound Name | 5-but-3-enyl-2-[[(3E,5E,7Z,9Z)-7-ethyl-8,9-difluoro-10-methoxy-6-methylundeca-3,5,7,9-tetraen-3-yl]oxymethyl]oxane;propane |
|---|---|
| PubChem CID | 143889546 |
| Molecular Formula | C28H46F2O3 |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | 5-but-3-enyl-2-[[(3E,5E,7Z,9Z)-7-ethyl-8,9-difluoro-10-methoxy-6-methylundeca-3,5,7,9-tetraen-3-yl]oxymethyl]oxane;propane |
| SMILES | C=CCCC1CCC(CO/C(=C/C=C(C)/C(CC)=C(F)/C(F)=C(\C)OC)CC)OC1.CCC |
| InChI | InChI=1S/C25H38F2O3.C3H8/c1-7-10-11-20-13-15-22(29-16-20)17-30-21(8-2)14-12-18(4)23(9-3)25(27)24(26)19(5)28-6;1-3-2/h7,12,14,20,22H,1,8-11,13,15-17H2,2-6H3;3H2,1-2H3/b18-12+,21-14+,24-19-,25-23-; |
| InChIKey | KKEXBUJTOARXGM-TWBKNPILSA-N |
| XLogP | 8.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|