C25H46F2O3 — CID 143889761
5-butyl-2-[[(6Z,8Z)-7,8-difluoro-9-methoxy-5,6-dimethyldeca-6,8-dien-2-yl]oxymethyl]oxane;ethane (PubChem CID 143889761) has the molecular formula C25H46F2O3 and a molecular weight of 432.64 g/mol. Its IUPAC name is 5-butyl-2-[[(6Z,8Z)-7,8-difluoro-9-methoxy-5,6-dimethyldeca-6,8-dien-2-yl]oxymethyl]oxane;ethane.
| Compound Name | 5-butyl-2-[[(6Z,8Z)-7,8-difluoro-9-methoxy-5,6-dimethyldeca-6,8-dien-2-yl]oxymethyl]oxane;ethane |
|---|---|
| PubChem CID | 143889761 |
| Molecular Formula | C25H46F2O3 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | 5-butyl-2-[[(6Z,8Z)-7,8-difluoro-9-methoxy-5,6-dimethyldeca-6,8-dien-2-yl]oxymethyl]oxane;ethane |
| SMILES | CC.CCCCC1CCC(COC(C)CCC(C)/C(C)=C(F)/C(F)=C(\C)OC)OC1 |
| InChI | InChI=1S/C23H40F2O3.C2H6/c1-7-8-9-20-12-13-21(28-14-20)15-27-17(3)11-10-16(2)18(4)22(24)23(25)19(5)26-6;1-2/h16-17,20-21H,7-15H2,1-6H3;1-2H3/b22-18-,23-19-; |
| InChIKey | JFASABFEABYFBH-WXHPZBCZSA-N |
| XLogP | 7.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|