C26H48F2O3 — CID 143889383
1-[2-[(3Z,5Z)-3-ethyl-4,5-difluoro-6-methoxy-2-methylhepta-3,5-dienoxy]propoxy]-4-propylcyclohexane;propane (PubChem CID 143889383) has the molecular formula C26H48F2O3 and a molecular weight of 446.66 g/mol. Its IUPAC name is 1-[2-[(3Z,5Z)-3-ethyl-4,5-difluoro-6-methoxy-2-methylhepta-3,5-dienoxy]propoxy]-4-propylcyclohexane;propane.
| Compound Name | 1-[2-[(3Z,5Z)-3-ethyl-4,5-difluoro-6-methoxy-2-methylhepta-3,5-dienoxy]propoxy]-4-propylcyclohexane;propane |
|---|---|
| PubChem CID | 143889383 |
| Molecular Formula | C26H48F2O3 |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | 1-[2-[(3Z,5Z)-3-ethyl-4,5-difluoro-6-methoxy-2-methylhepta-3,5-dienoxy]propoxy]-4-propylcyclohexane;propane |
| SMILES | CCC.CCCC1CCC(OCC(C)OCC(C)/C(CC)=C(F)/C(F)=C(\C)OC)CC1 |
| InChI | InChI=1S/C23H40F2O3.C3H8/c1-7-9-19-10-12-20(13-11-19)28-15-17(4)27-14-16(3)21(8-2)23(25)22(24)18(5)26-6;1-3-2/h16-17,19-20H,7-15H2,1-6H3;3H2,1-2H3/b22-18-,23-21-; |
| InChIKey | HYHJGPUMZXZDEH-ZRAYPICUSA-N |
| XLogP | 8.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|